1-Propanone,3-hydroxy-1,3,3-triphenyl- structure
|
Common Name | 1-Propanone,3-hydroxy-1,3,3-triphenyl- | ||
|---|---|---|---|---|
| CAS Number | 6624-02-8 | Molecular Weight | 302.36600 | |
| Density | 1.164g/cm3 | Boiling Point | 502.9ºC at 760 mmHg | |
| Molecular Formula | C21H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.1ºC | |
| Name | 3-hydroxy-1,3,3-triphenylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.164g/cm3 |
|---|---|
| Boiling Point | 502.9ºC at 760 mmHg |
| Molecular Formula | C21H18O2 |
| Molecular Weight | 302.36600 |
| Flash Point | 213.1ºC |
| Exact Mass | 302.13100 |
| PSA | 37.30000 |
| LogP | 4.19550 |
| Index of Refraction | 1.617 |
| InChIKey | NWFJIBVQGLMVTB-UHFFFAOYSA-N |
| SMILES | O=C(CC(O)(c1ccccc1)c1ccccc1)c1ccccc1 |
| HS Code | 2914400090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 1.1.3-Triphenyl-propanol-(1)-on-(3) |
| 1-Propanone,3-hydroxy-1,3,3-triphenyl |
| 3-Hydroxy-1,3,3-triphenyl-propan-1-on |
| 1,3,3-Triphenyl-3-hydroxypropan-1-one |
| 3-hydroxy-3,3-diphenyl-propiophenone |
| Diphenyl-phenacyl-carbinol |
| 3-HYDROXY-1,3,3-TRIPHENYL-PROPAN-1-ONE |