4-Quinolinecarboxylicacid, 1,2-dihydro-3-methyl-2-oxo- structure
|
Common Name | 4-Quinolinecarboxylicacid, 1,2-dihydro-3-methyl-2-oxo- | ||
|---|---|---|---|---|
| CAS Number | 6625-08-7 | Molecular Weight | 203.19400 | |
| Density | 1.351g/cm3 | Boiling Point | 401.9ºC at 760 mmHg | |
| Molecular Formula | C11H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.8ºC | |
| Name | 3-methyl-2-oxo-1H-quinoline-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.351g/cm3 |
|---|---|
| Boiling Point | 401.9ºC at 760 mmHg |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.19400 |
| Flash Point | 196.8ºC |
| Exact Mass | 203.05800 |
| PSA | 70.16000 |
| LogP | 1.53470 |
| Index of Refraction | 1.612 |
| InChIKey | WPRPBCUZWXWVLY-UHFFFAOYSA-N |
| SMILES | Cc1c(C(=O)O)c2ccccc2[nH]c1=O |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-quinolinecarboxylic acid,1,2-dihydro-3-methyl-2-oxo |
| 2-Hydroxy-3-methyl-4-quinolinecarboxylic acid |
| 2-Hydroxy-3-methyl-quinoline-4-carboxylic acid |
| 2-Hydroxy-3-methyl-chinolin-4-carbonsaeure |
| 3-methyl-2-oxo-1,2-dihydroquinoline-4-carboxylic acid |