2-(4-nitrophenyl)-1,3-dihydrobenzo[f][1,3]benzoxazine structure
|
Common Name | 2-(4-nitrophenyl)-1,3-dihydrobenzo[f][1,3]benzoxazine | ||
|---|---|---|---|---|
| CAS Number | 6625-52-1 | Molecular Weight | 306.31500 | |
| Density | 1.34g/cm3 | Boiling Point | 547.3ºC at 760 mmHg | |
| Molecular Formula | C18H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 284.8ºC | |
| Name | 2-(4-nitrophenyl)-1,3-dihydrobenzo[f][1,3]benzoxazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 547.3ºC at 760 mmHg |
| Molecular Formula | C18H14N2O3 |
| Molecular Weight | 306.31500 |
| Flash Point | 284.8ºC |
| Exact Mass | 306.10000 |
| PSA | 58.29000 |
| LogP | 4.69270 |
| Index of Refraction | 1.694 |
| InChIKey | RHTOWZJXOHGMDL-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(N2COc3ccc4ccccc4c3C2)cc1 |
|
~90%
2-(4-nitropheny... CAS#:6625-52-1 |
| Literature: Reddy, Mudumala Veeranarayana; Lim, Kwon Taek; Kim, Jong Tae; Jeong, Yeon Tae Journal of Chemical Research, 2012 , vol. 36, # 7 p. 398 - 401 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-(4-nitro-phenyl)-2,3-dihydro-1H-naphth[1,2-e][1,3]oxazine |
| 2-(4-Nitro-phenyl)-2,3-dihydro-1H-naphtho[1,2-e][1,3]oxazine |