PTH-α-aminobutyric acid
Modify Date: 2025-08-23 06:06:43
PTH-α-aminobutyric acid structure
|
Common Name | PTH-α-aminobutyric acid | ||
|---|---|---|---|---|
| CAS Number | 66256-32-4 | Molecular Weight | 220.29100 | |
| Density | 1.28g/cm3 | Boiling Point | 313.7ºC at 760 mmHg | |
| Molecular Formula | C11H12N2OS | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 143.5ºC | |
| Name | PTH-α-aminobutyric acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 313.7ºC at 760 mmHg |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.29100 |
| Flash Point | 143.5ºC |
| Exact Mass | 220.06700 |
| PSA | 64.43000 |
| LogP | 2.08010 |
| Index of Refraction | 1.654 |
| InChIKey | HIDHIQVHRMAIHA-UHFFFAOYSA-N |
| SMILES | CCC1NC(=S)N(c2ccccc2)C1=O |
| RIDADR | UN 2811 6.1/PG 3 |
|---|---|
| HS Code | 2933990090 |
|
~%
PTH-α-aminobuty... CAS#:66256-32-4 |
| Literature: Brautlecht Journal of Biological Chemistry, 1912 , vol. 10, p. 144 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-ethyl-3-phenyl-2-sulfanylideneimidazolidin-4-one |