1H-Isoindolium,2-[4-(diethylmethylammonio)butyl]octahydro-2-methyl-, iodide (1:2) structure
|
Common Name | 1H-Isoindolium,2-[4-(diethylmethylammonio)butyl]octahydro-2-methyl-, iodide (1:2) | ||
|---|---|---|---|---|
| CAS Number | 6626-47-7 | Molecular Weight | 409.41200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H38IN2+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl-methyl-[4-(2-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-ium-2-yl)butyl]azanium,iodide |
|---|
| Molecular Formula | C18H38IN2+ |
|---|---|
| Molecular Weight | 409.41200 |
| Exact Mass | 409.20800 |
| LogP | 0.48240 |
| InChIKey | CCLKRYATUGGTJC-UHFFFAOYSA-M |
| SMILES | CC[N+](C)(CC)CCCC[N+]1(C)CC2CCCCC2C1.[I-] |
|
~%
1H-Isoindolium,... CAS#:6626-47-7 |
| Literature: Rice et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 4911,4914 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |