2,6-Bis(2-chlorophenyl)pyrrolo[3,4-f]isoindole-1,3,5,7(2H,6H)-tetrone structure
|
Common Name | 2,6-Bis(2-chlorophenyl)pyrrolo[3,4-f]isoindole-1,3,5,7(2H,6H)-tetrone | ||
|---|---|---|---|---|
| CAS Number | 6626-72-8 | Molecular Weight | 437.23200 | |
| Density | 1.631g/cm3 | Boiling Point | 661.8ºC at 760 mmHg | |
| Molecular Formula | C22H10Cl2N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 354ºC | |
| Name | 2,6-bis(2-chlorophenyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.631g/cm3 |
|---|---|
| Boiling Point | 661.8ºC at 760 mmHg |
| Molecular Formula | C22H10Cl2N2O4 |
| Molecular Weight | 437.23200 |
| Flash Point | 354ºC |
| Exact Mass | 436.00200 |
| PSA | 78.14000 |
| LogP | 3.19760 |
| Index of Refraction | 1.736 |
| InChIKey | JOLBWDQIEJSDDC-UHFFFAOYSA-N |
| SMILES | O=c1c2cc3c(=O)n(-c4ccccc4Cl)c(=O)c3cc2c(=O)n1-c1ccccc1Cl |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N,N-Di-2-chlorphenylpyromellitimid |