2-aminoethanol; 2,4,6-trinitrophenol structure
|
Common Name | 2-aminoethanol; 2,4,6-trinitrophenol | ||
|---|---|---|---|---|
| CAS Number | 6627-48-1 | Molecular Weight | 290.18700 | |
| Density | N/A | Boiling Point | 303.6ºC at 760 mmHg | |
| Molecular Formula | C8H10N4O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 133.9ºC | |
| Name | 2-aminoethanol,2,4,6-trinitrophenol |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 303.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C8H10N4O8 |
| Molecular Weight | 290.18700 |
| Flash Point | 133.9ºC |
| Exact Mass | 290.05000 |
| PSA | 203.94000 |
| LogP | 2.32410 |
| InChIKey | ATOLNTNBXSEAPY-UHFFFAOYSA-N |
| SMILES | NCCO.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
|
~%
2-aminoethanol;... CAS#:6627-48-1 |
| Literature: Poonia, Narinder S.; Chandra, Ramesh; Sheldrick, W. S. Bulletin of the Chemical Society of Japan, 1990 , vol. 63, # 5 p. 1512 - 1514 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,4,6-trinitrophenol-2-aminoethanol(1:1) |
| ethanolammonium picrate |
| (2-Hydroxyethyl)ammonium picrate |
| 2-hydroxyethaninium picrate |
| 2-amino-ethanol,picrate |
| 2-Amino-aethanol,Picrat |
| Aethanolamin-pikrat |