[4-bromo-2-[[(3-chlorobenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate structure
|
Common Name | [4-bromo-2-[[(3-chlorobenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate | ||
|---|---|---|---|---|
| CAS Number | 6628-05-3 | Molecular Weight | 269.34300 | |
| Density | 1.5g/cm3 | Boiling Point | 418.4ºC at 760mmHg | |
| Molecular Formula | C10H11N3O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.9ºC | |
| Name | 2-ethylsulfanyl-4-methyl-thiazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5g/cm3 |
|---|---|
| Boiling Point | 418.4ºC at 760mmHg |
| Molecular Formula | C10H11N3O2S2 |
| Molecular Weight | 269.34300 |
| Flash Point | 206.9ºC |
| Exact Mass | 269.02900 |
| PSA | 126.47000 |
| LogP | 2.33848 |
| Index of Refraction | 1.639 |
| InChIKey | GLDYLBKSTPMITK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cnc(SCC)nc1SC#N |
|
~%
[4-bromo-2-[[(3... CAS#:6628-05-3 |
| Literature: Johnson; Chi Journal of the American Chemical Society, 1930 , vol. 52, p. 1580,1583 Recueil des Travaux Chimiques des Pays-Bas, 1930 , vol. 49, p. 197,199 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Aethylmercapto-4-thiocyanato-pyrimidin-5-carbonsaeure-aethylester |
| 2-ethylmercapto-4-thiocyanato-pyrimidine-5-carboxylic acid ethyl ester |
| 2-Aethylmercapto-4-methyl-thiazol |