(5Z)-5-[(2,5-dimethoxyphenyl)methylidene]-1-(2-fluorophenyl)-1,3-diazinane-2,4,6-trione structure
|
Common Name | (5Z)-5-[(2,5-dimethoxyphenyl)methylidene]-1-(2-fluorophenyl)-1,3-diazinane-2,4,6-trione | ||
|---|---|---|---|---|
| CAS Number | 6628-71-3 | Molecular Weight | 405.28400 | |
| Density | 1.385g/cm3 | Boiling Point | 438.8ºC at 760mmHg | |
| Molecular Formula | C23H17BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.2ºC | |
| Name | 3-bromo-2-(4-methoxyphenyl)-4,5-diphenylfuran |
|---|---|
| Synonym | More Synonyms |
| Density | 1.385g/cm3 |
|---|---|
| Boiling Point | 438.8ºC at 760mmHg |
| Molecular Formula | C23H17BrO2 |
| Molecular Weight | 405.28400 |
| Flash Point | 219.2ºC |
| Exact Mass | 404.04100 |
| PSA | 22.37000 |
| LogP | 7.05170 |
| Index of Refraction | 1.622 |
| InChIKey | WIDDTCYCMVKLQW-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2oc(-c3ccccc3)c(-c3ccccc3)c2Br)cc1 |
|
~%
(5Z)-5-[(2,5-di... CAS#:6628-71-3 |
| Literature: Allen; Wilson Journal of Organic Chemistry, 1940 , vol. 5, p. 146,153 |
|
~%
(5Z)-5-[(2,5-di... CAS#:6628-71-3 |
| Literature: Allen; Rosener Journal of the American Chemical Society, 1927 , vol. 49, p. 2112 |
|
~%
(5Z)-5-[(2,5-di... CAS#:6628-71-3 |
| Literature: Allen; Rosener Journal of the American Chemical Society, 1927 , vol. 49, p. 2112 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| 3-bromo-2-(4-methoxy-phenyl)-4,5-diphenyl-furan |
| 3-Brom-2-(4-methoxy-phenyl)-4,5-diphenyl-furan |