1H-Isoindole-1,3(2H)-dione, 2-[[(3-bromophenyl)amino]methyl]- structure
|
Common Name | 1H-Isoindole-1,3(2H)-dione, 2-[[(3-bromophenyl)amino]methyl]- | ||
|---|---|---|---|---|
| CAS Number | 6629-42-1 | Molecular Weight | 331.16400 | |
| Density | 1.625g/cm3 | Boiling Point | 495.5ºC at 760mmHg | |
| Molecular Formula | C15H11BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.5ºC | |
| Name | 2-[(3-bromoanilino)methyl]isoindole-1,3-dione |
|---|
| Density | 1.625g/cm3 |
|---|---|
| Boiling Point | 495.5ºC at 760mmHg |
| Molecular Formula | C15H11BrN2O2 |
| Molecular Weight | 331.16400 |
| Flash Point | 253.5ºC |
| Exact Mass | 330.00000 |
| PSA | 49.41000 |
| LogP | 3.12560 |
| Index of Refraction | 1.705 |
| InChIKey | VJDRUBBFWHNLGP-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1CNc1cccc(Br)c1 |
|
~%
1H-Isoindole-1,... CAS#:6629-42-1 |
| Literature: Winstead; Heine Journal of the American Chemical Society, 1955 , vol. 77, p. 1913 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |