2-[[(4-phenylphenyl)amino]methyl]isoindole-1,3-dione structure
|
Common Name | 2-[[(4-phenylphenyl)amino]methyl]isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 6629-43-2 | Molecular Weight | 328.36400 | |
| Density | 1.298g/cm3 | Boiling Point | 544.7ºC at 760 mmHg | |
| Molecular Formula | C21H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 283.2ºC | |
| Name | 2-[(4-phenylanilino)methyl]isoindole-1,3-dione |
|---|
| Density | 1.298g/cm3 |
|---|---|
| Boiling Point | 544.7ºC at 760 mmHg |
| Molecular Formula | C21H16N2O2 |
| Molecular Weight | 328.36400 |
| Flash Point | 283.2ºC |
| Exact Mass | 328.12100 |
| PSA | 49.41000 |
| LogP | 4.03010 |
| Index of Refraction | 1.685 |
| InChIKey | KZRPYIFCOJCUPS-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1CNc1ccc(-c2ccccc2)cc1 |
|
~%
2-[[(4-phenylph... CAS#:6629-43-2 |
| Literature: Winstead; Heine Journal of the American Chemical Society, 1955 , vol. 77, p. 1913 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |