6-(4-bromo-2,5-dimethoxy-phenyl)-5-nitro-piperidin-2-one
Modify Date: 2025-08-25 07:00:36
6-(4-bromo-2,5-dimethoxy-phenyl)-5-nitro-piperidin-2-one structure
|
Common Name | 6-(4-bromo-2,5-dimethoxy-phenyl)-5-nitro-piperidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 6629-44-3 | Molecular Weight | 280.32100 | |
| Density | 1.273g/cm3 | Boiling Point | 469.6ºC at 760 mmHg | |
| Molecular Formula | C17H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.8ºC | |
| Name | 2-[(2,5-dimethylanilino)methyl]isoindole-1,3-dione |
|---|
| Density | 1.273g/cm3 |
|---|---|
| Boiling Point | 469.6ºC at 760 mmHg |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.32100 |
| Flash Point | 237.8ºC |
| Exact Mass | 280.12100 |
| PSA | 49.41000 |
| LogP | 2.97990 |
| Index of Refraction | 1.659 |
| InChIKey | DOMDOBKAHVGLJL-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C)c(NCN2C(=O)c3ccccc3C2=O)c1 |
| HS Code | 2925190090 |
|---|
|
~%
6-(4-bromo-2,5-... CAS#:6629-44-3 |
| Literature: Winstead; Heine Journal of the American Chemical Society, 1955 , vol. 77, p. 1913 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |