Acetamide,N-[4-[[[(butylamino)carbonyl]amino]sulfonyl]phenyl]- structure
|
Common Name | Acetamide,N-[4-[[[(butylamino)carbonyl]amino]sulfonyl]phenyl]- | ||
|---|---|---|---|---|
| CAS Number | 6630-00-8 | Molecular Weight | 313.37300 | |
| Density | 1.278g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H19N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[4-(butylcarbamoylsulfamoyl)phenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.278g/cm3 |
|---|---|
| Molecular Formula | C13H19N3O4S |
| Molecular Weight | 313.37300 |
| Exact Mass | 313.11000 |
| PSA | 112.75000 |
| LogP | 3.36860 |
| Index of Refraction | 1.559 |
| InChIKey | ZIFOWKKZIWXFJO-UHFFFAOYSA-N |
| SMILES | CCCCNC(=O)NS(=O)(=O)c1ccc(NC(C)=O)cc1 |
|
~%
Acetamide,N-[4-... CAS#:6630-00-8 |
| Literature: Tull,R. et al. Journal of the Chemical Society [Section] C: Organic, 1967 , p. 701 - 702 |
|
~%
Acetamide,N-[4-... CAS#:6630-00-8 |
| Literature: Hoekfelt,B.; Joensson,A. Journal of Medicinal and Pharmaceutical Chemistry, 1962 , vol. 5, p. 231 - 239 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-Butyl-N'-<4-acetylamino-benzolsulfonyl>-harnstoff |
| N1-p-Acetaminobenzolsulfonyl-N2-butyl-harnstoff |