6-(5-carboxypentylcarbamoylamino)hexanoic acid
Modify Date: 2025-09-28 07:46:21
6-(5-carboxypentylcarbamoylamino)hexanoic acid structure
|
Common Name | 6-(5-carboxypentylcarbamoylamino)hexanoic acid | ||
|---|---|---|---|---|
| CAS Number | 6630-04-2 | Molecular Weight | 288.34000 | |
| Density | 1.166g/cm3 | Boiling Point | 587.6ºC at 760 mmHg | |
| Molecular Formula | C13H24N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 309.2ºC | |
| Name | 6-(5-carboxypentylcarbamoylamino)hexanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.166g/cm3 |
|---|---|
| Boiling Point | 587.6ºC at 760 mmHg |
| Molecular Formula | C13H24N2O5 |
| Molecular Weight | 288.34000 |
| Flash Point | 309.2ºC |
| Exact Mass | 288.16900 |
| PSA | 115.73000 |
| LogP | 2.35740 |
| Index of Refraction | 1.499 |
| InChIKey | LXNSSMBDZOAFCT-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCCCNC(=O)NCCCCCC(=O)O |
| HS Code | 2924199090 |
|---|
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1,3-Bis(5-carboxypentyl)urea |
| N6-N6'-Carbonyl-bis-6-amino-capronsaeure |
| 6,6'-Ureylen-di-hexansaeure |
| N,N'-Bis-(5-carboxy-pentyl)-harnstoff |
| 6,6'-ureylene-di-hexanoic acid |
| hexanoic acid,6,6'-(carbonyldiimino)bis |