1-(3-methylphenoxy)-3-(4-phenylpiperazin-1-yl)propan-2-ol structure
|
Common Name | 1-(3-methylphenoxy)-3-(4-phenylpiperazin-1-yl)propan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 66307-10-6 | Molecular Weight | 326.43300 | |
| Density | 1.127g/cm3 | Boiling Point | 511.1ºC at 760 mmHg | |
| Molecular Formula | C20H26N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.9ºC | |
| Name | 1-(3-methylphenoxy)-3-(4-phenylpiperazin-1-yl)propan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.127g/cm3 |
|---|---|
| Boiling Point | 511.1ºC at 760 mmHg |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.43300 |
| Flash Point | 262.9ºC |
| Exact Mass | 326.19900 |
| PSA | 35.94000 |
| LogP | 2.55980 |
| Index of Refraction | 1.581 |
| InChIKey | NBGZKUGCLABWPY-UHFFFAOYSA-N |
| SMILES | Cc1cccc(OCC(O)CN2CCN(c3ccccc3)CC2)c1 |
|
~%
1-(3-methylphen... CAS#:66307-10-6 |
| Literature: Pollard; Fernandez Journal of Organic Chemistry, 1958 , vol. 23, p. 1935 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1-(4-phenylphenylene)-2-methyl-propan-1-one |
| 1-(4-phenyl-piperazino)-3-m-tolyloxy-propan-2-ol |
| p-C6H5C6H4C(O)CH(CH3)2 |
| 1-[(1,1'-Biphenyl)-4-yl]-2-methylpropan-1-on |
| 1-(4-phenyl-piperazin-1-yl)-3-m-tolyloxy-propan-2-ol |
| 4-biphenylisopropylketone |
| 1-biphenyl-4-yl-2-methyl-propan-1-one |