(3Z)-3-[(4-nitrophenyl)methylidene]-8-phenyl-4-thia-1,6,7-triazabicyclo[3.3.0]octa-5,7-dien-2-one structure
|
Common Name | (3Z)-3-[(4-nitrophenyl)methylidene]-8-phenyl-4-thia-1,6,7-triazabicyclo[3.3.0]octa-5,7-dien-2-one | ||
|---|---|---|---|---|
| CAS Number | 6632-00-4 | Molecular Weight | 263.78600 | |
| Density | 1.52g/cm3 | Boiling Point | 580.5ºC at 760 mmHg | |
| Molecular Formula | C14H14ClNS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 304.9ºC | |
| Name | N-(((4-chlorophenyl)thio)methyl)-4-methylaniline |
|---|
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 580.5ºC at 760 mmHg |
| Molecular Formula | C14H14ClNS |
| Molecular Weight | 263.78600 |
| Flash Point | 304.9ºC |
| Exact Mass | 263.05400 |
| PSA | 37.33000 |
| LogP | 4.88310 |
| Index of Refraction | 1.766 |
| InChIKey | WVXCLKIMORBOGJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NCSc2ccc(Cl)cc2)cc1 |
|
~%
(3Z)-3-[(4-nitr... CAS#:6632-00-4 |
| Literature: Grillot; Schaffrath Journal of Organic Chemistry, 1959 , vol. 24, p. 1035,1036 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |