Benzenamine,N-[[(4-chlorophenyl)thio]methyl]-4-methoxy-N-methyl- structure
|
Common Name | Benzenamine,N-[[(4-chlorophenyl)thio]methyl]-4-methoxy-N-methyl- | ||
|---|---|---|---|---|
| CAS Number | 6632-06-0 | Molecular Weight | 293.81200 | |
| Density | 1.24g/cm3 | Boiling Point | 424.6ºC at 760 mmHg | |
| Molecular Formula | C15H16ClNOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.6ºC | |
| Name | 4-[4-(dimethylamino)phenyl]imino-2-methoxycyclohexa-2,5-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 424.6ºC at 760 mmHg |
| Molecular Formula | C15H16ClNOS |
| Molecular Weight | 293.81200 |
| Flash Point | 210.6ºC |
| Exact Mass | 293.06400 |
| PSA | 37.77000 |
| LogP | 4.53460 |
| Index of Refraction | 1.625 |
| InChIKey | VHWYKMYFARSTHU-UHFFFAOYSA-N |
| SMILES | COc1ccc(N(C)CSc2ccc(Cl)cc2)cc1 |
|
~%
Benzenamine,N-[... CAS#:6632-06-0 |
| Literature: Grillot; Schaffrath Journal of Organic Chemistry, 1959 , vol. 24, p. 1035,1036 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| <4-Chlor-phenyl>-<N-methyl-N-phenyl-aminomethyl>-sulfid |
| <N-Methyl-N-p-anisyl-aminomethyl>-<p-chlor-phenyl>-sulfid |