1-[(2,4,6-trimethylphenyl)sulfanylmethyl]piperidine structure
|
Common Name | 1-[(2,4,6-trimethylphenyl)sulfanylmethyl]piperidine | ||
|---|---|---|---|---|
| CAS Number | 6632-10-6 | Molecular Weight | 249.41500 | |
| Density | 1.04g/cm3 | Boiling Point | 325.7ºC at 760 mmHg | |
| Molecular Formula | C15H23NS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.7ºC | |
| Name | 1-[(2,4,6-trimethylphenyl)sulfanylmethyl]piperidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.04g/cm3 |
|---|---|
| Boiling Point | 325.7ºC at 760 mmHg |
| Molecular Formula | C15H23NS |
| Molecular Weight | 249.41500 |
| Flash Point | 150.7ºC |
| Exact Mass | 249.15500 |
| PSA | 28.54000 |
| LogP | 4.08520 |
| Index of Refraction | 1.57 |
| InChIKey | KFKSYDSVYUWMHK-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(SCN2CCCCC2)c(C)c1 |
|
~%
1-[(2,4,6-trime... CAS#:6632-10-6 |
| Literature: Grillot et al. Journal of the American Chemical Society, 1954 , vol. 76, p. 3969 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-(m-chlorophenyl)-2-propanone oxime |
| 1-(mesitylmercapto-methyl)-piperidine |
| Benzene,1-bromo-3-(2-bromopropyl) |
| 1-(m-Bromphenyl)-2-brompropan |