1-methyl-2,5-diphenyl-pyrazol-3-one structure
|
Common Name | 1-methyl-2,5-diphenyl-pyrazol-3-one | ||
|---|---|---|---|---|
| CAS Number | 6632-12-8 | Molecular Weight | 250.29500 | |
| Density | 1.209g/cm3 | Boiling Point | 389.7ºC at 760 mmHg | |
| Molecular Formula | C16H14N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.1ºC | |
| Name | 1-methyl-2,5-diphenylpyrazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.209g/cm3 |
|---|---|
| Boiling Point | 389.7ºC at 760 mmHg |
| Molecular Formula | C16H14N2O |
| Molecular Weight | 250.29500 |
| Flash Point | 170.1ºC |
| Exact Mass | 250.11100 |
| PSA | 26.93000 |
| LogP | 2.84300 |
| Index of Refraction | 1.636 |
| InChIKey | BDBIMDGQZXKYGF-UHFFFAOYSA-N |
| SMILES | Cn1c(-c2ccccc2)cc(=O)n1-c1ccccc1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-methyl-2,5-diphenyl-1,2-dihydro-3h-pyrazol-3-one |
| 1,2-dihydro-2-methyl-1,3-diphenylpyrazol-5-one |
| 1-Methyl-2,5-diphenyl-1,2-dihydro-pyrazol-3-on |
| 1-methyl-2,5-diphenyl-1,2-dihydro-pyrazol-3-one |
| HMS3089E03 |