(4-nitrophenyl)-(2,4,6-trimethylphenyl)sulfanyl-methanone structure
|
Common Name | (4-nitrophenyl)-(2,4,6-trimethylphenyl)sulfanyl-methanone | ||
|---|---|---|---|---|
| CAS Number | 6632-13-9 | Molecular Weight | 301.36000 | |
| Density | 1.27g/cm3 | Boiling Point | 433.1ºC at 760 mmHg | |
| Molecular Formula | C16H15NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.8ºC | |
| Name | 4-bromoiminocyclohexa-2,5-dien-1-one |
|---|
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 433.1ºC at 760 mmHg |
| Molecular Formula | C16H15NO3S |
| Molecular Weight | 301.36000 |
| Flash Point | 215.8ºC |
| Exact Mass | 301.07700 |
| PSA | 88.19000 |
| LogP | 4.97570 |
| Index of Refraction | 1.627 |
| InChIKey | GCIHWBKXTJXORH-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(SC(=O)c2ccc([N+](=O)[O-])cc2)c(C)c1 |
|
~%
(4-nitrophenyl)... CAS#:6632-13-9 |
| Literature: Grillot et al. Journal of the American Chemical Society, 1954 , vol. 76, p. 3969 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |