1-Hexanamine,3,5,5-trimethyl-N-[1-(1-methylethyl)-2-propyn-1-yl]- structure
|
Common Name | 1-Hexanamine,3,5,5-trimethyl-N-[1-(1-methylethyl)-2-propyn-1-yl]- | ||
|---|---|---|---|---|
| CAS Number | 6632-62-8 | Molecular Weight | 223.39700 | |
| Density | 0.827g/cm3 | Boiling Point | 293ºC at 760mmHg | |
| Molecular Formula | C15H29N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 124.2ºC | |
| Name | 3,5,5-trimethyl-N-(4-methylpent-1-yn-3-yl)hexan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.827g/cm3 |
|---|---|
| Boiling Point | 293ºC at 760mmHg |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.39700 |
| Flash Point | 124.2ºC |
| Exact Mass | 223.23000 |
| PSA | 12.03000 |
| LogP | 4.08710 |
| Index of Refraction | 1.451 |
| InChIKey | WYFQZULWUIYWHY-UHFFFAOYSA-N |
| SMILES | C#CC(NCCC(C)CC(C)(C)C)C(C)C |
|
~%
1-Hexanamine,3,... CAS#:6632-62-8 |
| Literature: Rohm and Haas Co. Patent: US2665311 , 1950 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| (1-Isopropyl-prop-2-inyl)-(3,5,5-trimethyl-hexyl)-amin |
| N-(1-isopropylprop-2-ynyl)-3,5,5-trimethyl-hexan-1-amine |
| (1-isopropyl-prop-2-ynyl)-(3,5,5-trimethyl-hexyl)-amine |