Piperazine,1,4-bis(2-bromo-3-methyl-1-oxobutyl)- (9CI) structure
|
Common Name | Piperazine,1,4-bis(2-bromo-3-methyl-1-oxobutyl)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 6632-82-2 | Molecular Weight | 412.16100 | |
| Density | 1.482g/cm3 | Boiling Point | 479.4ºC at 760 mmHg | |
| Molecular Formula | C14H24Br2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.7ºC | |
| Name | 2-bromo-1-[4-(2-bromo-3-methylbutanoyl)piperazin-1-yl]-3-methylbutan-1-one |
|---|
| Density | 1.482g/cm3 |
|---|---|
| Boiling Point | 479.4ºC at 760 mmHg |
| Molecular Formula | C14H24Br2N2O2 |
| Molecular Weight | 412.16100 |
| Flash Point | 243.7ºC |
| Exact Mass | 410.02000 |
| PSA | 40.62000 |
| LogP | 2.37200 |
| Index of Refraction | 1.539 |
| InChIKey | PMHFQJAWXHSCLF-UHFFFAOYSA-N |
| SMILES | CC(C)C(Br)C(=O)N1CCN(C(=O)C(Br)C(C)C)CC1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |