Benzenebutanoic acid,4-methyl-a-(4-methylphenyl)-b-oxo-, ethyl ester structure
|
Common Name | Benzenebutanoic acid,4-methyl-a-(4-methylphenyl)-b-oxo-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 6632-84-4 | Molecular Weight | 310.38700 | |
| Density | 1.097g/cm3 | Boiling Point | 421.1ºC at 760 mmHg | |
| Molecular Formula | C20H22O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.7ºC | |
| Name | ethyl 2,4-bis(4-methylphenyl)-3-oxobutanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.097g/cm3 |
|---|---|
| Boiling Point | 421.1ºC at 760 mmHg |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.38700 |
| Flash Point | 182.7ºC |
| Exact Mass | 310.15700 |
| PSA | 43.37000 |
| LogP | 3.76190 |
| Index of Refraction | 1.551 |
| InChIKey | UOPYGARWUQOFNP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)Cc1ccc(C)cc1)c1ccc(C)cc1 |
| HS Code | 2918300090 |
|---|
|
~%
Benzenebutanoic... CAS#:6632-84-4 |
| Literature: Zaugg; Rapala; Leffler Journal of the American Chemical Society, 1948 , vol. 70, p. 3224,3226 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2,4-Di-p-tolyl-acetessigsaeure-aethylester |
| 2,4-di-p-tolyl-acetoacetic acid ethyl ester |