N-(3-chloro-9-oxo-fluoren-2-yl)acetamide structure
|
Common Name | N-(3-chloro-9-oxo-fluoren-2-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 6633-21-2 | Molecular Weight | 271.69800 | |
| Density | 1.431g/cm3 | Boiling Point | 530.8ºC at 760 mmHg | |
| Molecular Formula | C15H10ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274.8ºC | |
| Name | 3x-2-aaa |
|---|---|
| Synonym | More Synonyms |
| Density | 1.431g/cm3 |
|---|---|
| Boiling Point | 530.8ºC at 760 mmHg |
| Molecular Formula | C15H10ClNO2 |
| Molecular Weight | 271.69800 |
| Flash Point | 274.8ºC |
| Exact Mass | 271.04000 |
| PSA | 46.17000 |
| LogP | 3.58280 |
| Index of Refraction | 1.696 |
| InChIKey | CHPDUKAKZMXLOX-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cc2c(cc1Cl)-c1ccccc1C2=O |
|
~%
N-(3-chloro-9-o... CAS#:6633-21-2 |
| Literature: Bell; Gibson Journal of the Chemical Society, 1955 , p. 3560 |
|
~%
N-(3-chloro-9-o... CAS#:6633-21-2 |
| Literature: Bell; Gibson Journal of the Chemical Society, 1955 , p. 3560 |
| 2-Acetylamino-3-chlor-fluoren-9-on |
| 3-Chlor-2-acetamino-anthrachinon |
| Anthraquinone,2-acetamido-3-chloro |
| 2-Acetamido-3-chloroanthraquinone |