2,4,6-Pyrimidinetriamine,N4-(3-chlorophenyl)- structure
|
Common Name | 2,4,6-Pyrimidinetriamine,N4-(3-chlorophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 6633-67-6 | Molecular Weight | 235.67300 | |
| Density | 1.487g/cm3 | Boiling Point | 524.5ºC at 760 mmHg | |
| Molecular Formula | C10H10ClN5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 271ºC | |
| Name | N4-(3-chlorophenyl)pyrimidine-2,4,6-triamine |
|---|
| Density | 1.487g/cm3 |
|---|---|
| Boiling Point | 524.5ºC at 760 mmHg |
| Molecular Formula | C10H10ClN5 |
| Molecular Weight | 235.67300 |
| Flash Point | 271ºC |
| Exact Mass | 235.06200 |
| PSA | 89.85000 |
| LogP | 3.27340 |
| Index of Refraction | 1.759 |
| InChIKey | UBLVYMZBOMHJKQ-UHFFFAOYSA-N |
| SMILES | Nc1cc(Nc2cccc(Cl)c2)nc(N)n1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |