Benzene,1,3-bis(2-methyl-2-propen-1-yl)-2-(2-propen-1-yloxy)- structure
|
Common Name | Benzene,1,3-bis(2-methyl-2-propen-1-yl)-2-(2-propen-1-yloxy)- | ||
|---|---|---|---|---|
| CAS Number | 6633-99-4 | Molecular Weight | 242.35600 | |
| Density | 0.921g/cm3 | Boiling Point | 322.3ºC at 760mmHg | |
| Molecular Formula | C17H22O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 126.7ºC | |
| Name | 1,3-bis(2-methylprop-2-enyl)-2-prop-2-enoxybenzene |
|---|
| Density | 0.921g/cm3 |
|---|---|
| Boiling Point | 322.3ºC at 760mmHg |
| Molecular Formula | C17H22O |
| Molecular Weight | 242.35600 |
| Flash Point | 126.7ºC |
| Exact Mass | 242.16700 |
| PSA | 9.23000 |
| LogP | 4.48860 |
| Index of Refraction | 1.51 |
| InChIKey | FMNIFXPOQQYTAR-UHFFFAOYSA-N |
| SMILES | C=CCOc1c(CC(=C)C)cccc1CC(=C)C |
|
~%
Benzene,1,3-bis... CAS#:6633-99-4 |
| Literature: Curtin; Johnson Journal of the American Chemical Society, 1956 , vol. 78, p. 2611,2614 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |