1-[2-[4-[[4-(2-acetylsulfanylethyl)phenyl]methyl]phenyl]ethylsulfanyl]ethanone structure
|
Common Name | 1-[2-[4-[[4-(2-acetylsulfanylethyl)phenyl]methyl]phenyl]ethylsulfanyl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 6634-07-7 | Molecular Weight | 372.54400 | |
| Density | 1.154g/cm3 | Boiling Point | 515.8ºC at 760 mmHg | |
| Molecular Formula | C21H24O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.3ºC | |
| Name | S,S'-((methylenebis(4,1-phenylene))bis(ethane-2,1-diyl)) diethanethioate |
|---|
| Density | 1.154g/cm3 |
|---|---|
| Boiling Point | 515.8ºC at 760 mmHg |
| Molecular Formula | C21H24O2S2 |
| Molecular Weight | 372.54400 |
| Flash Point | 212.3ºC |
| Exact Mass | 372.12200 |
| PSA | 84.74000 |
| LogP | 4.92180 |
| Index of Refraction | 1.592 |
| InChIKey | XTZCFGUBKYUPPW-UHFFFAOYSA-N |
| SMILES | CC(=O)SCCc1ccc(Cc2ccc(CCSC(C)=O)cc2)cc1 |
|
~%
1-[2-[4-[[4-(2-... CAS#:6634-07-7 |
| Literature: Marvel; Chambers Journal of the American Chemical Society, 1948 , vol. 70, p. 997 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |