3-carbamimidoylsulfanyl-N-phenyl-propanamide structure
|
Common Name | 3-carbamimidoylsulfanyl-N-phenyl-propanamide | ||
|---|---|---|---|---|
| CAS Number | 6634-43-1 | Molecular Weight | 259.75600 | |
| Density | 1.27g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H14ClN3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3-anilino-3-oxopropyl) carbamimidothioate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Molecular Formula | C10H14ClN3OS |
| Molecular Weight | 259.75600 |
| Exact Mass | 259.05500 |
| PSA | 104.27000 |
| LogP | 3.31690 |
| Index of Refraction | 1.621 |
| InChIKey | LWBFGXVSSWFHCV-UHFFFAOYSA-N |
| SMILES | Cl.N=C(N)SCCC(=O)Nc1ccccc1 |
|
~%
3-carbamimidoyl... CAS#:6634-43-1 |
| Literature: Weiss; Sokol Journal of the American Chemical Society, 1950 , vol. 72, p. 1687 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| S-<2-(N-Phenylcarbamoyl)-aethyl>-isothioharnstoff |
| 3-carbamimidoylmercapto-propionic acid anilide,hydrochloride |
| 3-Carbamimidoylmercapto-propionsaeure-anilid,Hydrochlorid |