2-(6-chloroquinolin-1-yl)-1-naphthalen-2-yl-ethanone structure
|
Common Name | 2-(6-chloroquinolin-1-yl)-1-naphthalen-2-yl-ethanone | ||
|---|---|---|---|---|
| CAS Number | 6634-83-9 | Molecular Weight | 412.70700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H15BrClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(6-chloroquinolin-1-ium-1-yl)-1-naphthalen-2-ylethanone,bromide |
|---|
| Molecular Formula | C21H15BrClNO |
|---|---|
| Molecular Weight | 412.70700 |
| Exact Mass | 411.00300 |
| PSA | 20.95000 |
| LogP | 1.82080 |
| InChIKey | PBCLZLJXQHMDMF-UHFFFAOYSA-M |
| SMILES | O=C(C[n+]1cccc2cc(Cl)ccc21)c1ccc2ccccc2c1.[Br-] |
|
~%
2-(6-chloroquin... CAS#:6634-83-9 |
| Literature: Bahner et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 3499 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |