butyl-ethyl-[2-oxo-2-(4-phenylphenyl)ethyl]sulfanium,bromide structure
|
Common Name | butyl-ethyl-[2-oxo-2-(4-phenylphenyl)ethyl]sulfanium,bromide | ||
|---|---|---|---|---|
| CAS Number | 6634-95-3 | Molecular Weight | 393.38100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H25BrOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | butyl-ethyl-[2-oxo-2-(4-phenylphenyl)ethyl]sulfanium,bromide |
|---|
| Molecular Formula | C20H25BrOS |
|---|---|
| Molecular Weight | 393.38100 |
| Exact Mass | 392.08100 |
| PSA | 42.37000 |
| LogP | 1.97860 |
| InChIKey | WCDMJASHMGKCJS-UHFFFAOYSA-M |
| SMILES | CCCC[S+](CC)CC(=O)c1ccc(-c2ccccc2)cc1.[Br-] |
|
~%
butyl-ethyl-[2-... CAS#:6634-95-3 |
| Literature: Rutter Journal of the American Chemical Society, 1951 , vol. 73, p. 5905 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |