[3-amino-4-(methylamino)phenyl] phenyl ketone structure
|
Common Name | [3-amino-4-(methylamino)phenyl] phenyl ketone | ||
|---|---|---|---|---|
| CAS Number | 66353-69-3 | Molecular Weight | 226.27400 | |
| Density | 1.195g/cm3 | Boiling Point | 430.6ºC at 760 mmHg | |
| Molecular Formula | C14H14N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.2ºC | |
| Name | [3-amino-4-(methylamino)phenyl]-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.195g/cm3 |
|---|---|
| Boiling Point | 430.6ºC at 760 mmHg |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.27400 |
| Flash Point | 214.2ºC |
| Exact Mass | 226.11100 |
| PSA | 55.12000 |
| LogP | 3.19570 |
| Index of Refraction | 1.66 |
| InChIKey | SFVWUAIFCISEEK-UHFFFAOYSA-N |
| SMILES | CNc1ccc(C(=O)c2ccccc2)cc1N |
|
~83%
[3-amino-4-(met... CAS#:66353-69-3 |
| Literature: Navarrete-Vazquez, Gabriel; Yepez, Lilian; Hernandez-Campos, Alicia; Tapia, Amparo; Hernandez-Luis, Francisco; Cedillo, Roberto; Gonzalez, Jose; Martinez-Fernandez, Antonio; Martinez-Grueiro, Mercedes; Castillo, Rafael Bioorganic and Medicinal Chemistry, 2003 , vol. 11, # 21 p. 4615 - 4622 |
|
~%
[3-amino-4-(met... CAS#:66353-69-3 |
| Literature: El-Hamouly; Abd-Allah; Tawfik Egyptian Journal of Chemistry, 2004 , vol. 47, # 3 p. 333 - 343 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 3-Amino-4-methylamino-benzophenon |
| EINECS 266-326-2 |
| 4-benzoyl-N1-methylbenzene-1,2-diamine |
| (3-Amino-4-(methylamino)phenyl) phenyl ketone |
| 3-amino-4-(methylamino)benzophenone |
| [3-amino-4-(methylamino)phenyl](phenyl)methanone |