9(10H)-Anthracenone, 2-chloro-10-(4-chlorophenyl)-10-hydroxy- structure
|
Common Name | 9(10H)-Anthracenone, 2-chloro-10-(4-chlorophenyl)-10-hydroxy- | ||
|---|---|---|---|---|
| CAS Number | 6636-08-4 | Molecular Weight | 355.21400 | |
| Density | 1.443g/cm3 | Boiling Point | 526.8ºC at 760mmHg | |
| Molecular Formula | C20H12Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 272.4ºC | |
| Name | 2-chloro-10-(4-chlorophenyl)-10-hydroxyanthracen-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.443g/cm3 |
|---|---|
| Boiling Point | 526.8ºC at 760mmHg |
| Molecular Formula | C20H12Cl2O2 |
| Molecular Weight | 355.21400 |
| Flash Point | 272.4ºC |
| Exact Mass | 354.02100 |
| PSA | 37.30000 |
| LogP | 4.82200 |
| Index of Refraction | 1.692 |
| InChIKey | ACEBIJONOSSIFL-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(O)(c2ccc(Cl)cc2)c2ccc(Cl)cc21 |
|
~%
9(10H)-Anthrace... CAS#:6636-08-4 |
| Literature: Blicke; Patelski Journal of the American Chemical Society, 1936 , vol. 58, p. 273,274 |
|
~%
9(10H)-Anthrace... CAS#:6636-08-4 |
| Literature: Blicke; Patelski Journal of the American Chemical Society, 1936 , vol. 58, p. 273,274 |
|
~%
9(10H)-Anthrace... CAS#:6636-08-4 |
| Literature: Blicke; Patelski Journal of the American Chemical Society, 1936 , vol. 58, p. 273,274 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-chloro-10-(4-chloro-phenyl)-10-hydroxy-anthrone |
| 2-Chlor-10-(4-chlor-phenyl)-10-hydroxy-anthron |
| 2-chloro-10-(4-chlorophenyl)-10-hydroxyanthracen-9(10h)-one |