[2-[hydroxy-(4-methoxyphenyl)methyl]phenyl]-(4-methoxyphenyl)methanol structure
|
Common Name | [2-[hydroxy-(4-methoxyphenyl)methyl]phenyl]-(4-methoxyphenyl)methanol | ||
|---|---|---|---|---|
| CAS Number | 6636-09-5 | Molecular Weight | 350.40800 | |
| Density | 1.196g/cm3 | Boiling Point | 552.2ºC at 760 mmHg | |
| Molecular Formula | C22H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 287.8ºC | |
| Name | Silane,1,1'-(1,2-ethanediyl)bis[1-ethenyl-1,1-dimethyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.196g/cm3 |
|---|---|
| Boiling Point | 552.2ºC at 760 mmHg |
| Molecular Formula | C22H22O4 |
| Molecular Weight | 350.40800 |
| Flash Point | 287.8ºC |
| Exact Mass | 350.15200 |
| PSA | 58.92000 |
| LogP | 3.86720 |
| Index of Refraction | 1.608 |
| InChIKey | DCINNCYBGGDENL-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(O)c2ccccc2C(O)c2ccc(OC)cc2)cc1 |
|
~%
[2-[hydroxy-(4-... CAS#:6636-09-5 |
| Literature: Li, Guijie; Zhou, Shaolin; Su, Guowei; Liu, Yuanhong; Wang, Peng George Journal of Organic Chemistry, 2007 , vol. 72, # 25 p. 9830 - 9833 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3,3,6,6-Tetramethyl-3,6-disila-1,7-octadiene |
| 1,4-bis(dimethylvinylsilyl)ethane |
| 1,2-Bis-(vinyldimethylsilyl)-aethan |
| 1,2-bis(vinyldimethylsilyl)ethane |
| 1,2-bis(dimethylvinylsilyl)ethane |
| 1,4 divinyl-1,1,4,4 tetramethyldisilylethylene |
| Silane,1,2-ethanediylbis[ethenyldimethyl-(9CI) |