1-Phenanthreneaceticacid, 2-carboxy-1,2,3,4,5,6,7,8-octahydro-9-methoxy-2-methyl- structure
|
Common Name | 1-Phenanthreneaceticacid, 2-carboxy-1,2,3,4,5,6,7,8-octahydro-9-methoxy-2-methyl- | ||
|---|---|---|---|---|
| CAS Number | 6636-47-1 | Molecular Weight | 332.39100 | |
| Density | 1.231g/cm3 | Boiling Point | 569.5ºC at 760 mmHg | |
| Molecular Formula | C19H24O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.5ºC | |
| Name | 1-(carboxymethyl)-9-methoxy-2-methyl-3,4,5,6,7,8-hexahydro-1H-phenanthrene-2-carboxylic acid |
|---|
| Density | 1.231g/cm3 |
|---|---|
| Boiling Point | 569.5ºC at 760 mmHg |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.39100 |
| Flash Point | 205.5ºC |
| Exact Mass | 332.16200 |
| PSA | 83.83000 |
| LogP | 3.16940 |
| Index of Refraction | 1.566 |
| InChIKey | GFORJKNNPIYVSZ-UHFFFAOYSA-N |
| SMILES | COc1cc2c(c3c1CCCC3)CCC(C)(C(=O)O)C2CC(=O)O |
|
~%
1-Phenanthrenea... CAS#:6636-47-1 |
| Literature: Bachmann; Ness Journal of the American Chemical Society, 1942 , vol. 64, p. 536,538 |
|
~%
1-Phenanthrenea... CAS#:6636-47-1 |
| Literature: Bachmann; Ness Journal of the American Chemical Society, 1942 , vol. 64, p. 536,538 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |