[1,1'-Biphenyl]-2-carboxylicacid, 4,6-dinitro- structure
|
Common Name | [1,1'-Biphenyl]-2-carboxylicacid, 4,6-dinitro- | ||
|---|---|---|---|---|
| CAS Number | 6638-63-7 | Molecular Weight | 288.21200 | |
| Density | 1.509g/cm3 | Boiling Point | 433.3ºC at 760 mmHg | |
| Molecular Formula | C13H8N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.7ºC | |
| Name | 3,5-dinitro-2-phenylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.509g/cm3 |
|---|---|
| Boiling Point | 433.3ºC at 760 mmHg |
| Molecular Formula | C13H8N2O6 |
| Molecular Weight | 288.21200 |
| Flash Point | 182.7ºC |
| Exact Mass | 288.03800 |
| PSA | 128.94000 |
| LogP | 3.91460 |
| Index of Refraction | 1.664 |
| InChIKey | SQEFLQABIQQJLA-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1-c1ccccc1 |
|
~%
[1,1'-Biphenyl]... CAS#:6638-63-7 |
| Literature: Lesslie; Turner Journal of the Chemical Society, 1930 , p. 1758,1761 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4,6-dinitrobiphenyl-2-carboxylic acid |
| 4,6-Dinitro-biphenyl-2-carbonsaeure |