3-Hexadecen-1-ol,3,7,11,15-tetramethyl structure
|
Common Name | 3-Hexadecen-1-ol,3,7,11,15-tetramethyl | ||
|---|---|---|---|---|
| CAS Number | 6638-82-0 | Molecular Weight | 519.63300 | |
| Density | 1.263g/cm3 | Boiling Point | 642.4ºC at 760 mmHg | |
| Molecular Formula | C33H33N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.1ºC | |
| Name | 3-Hexadecen-1-ol,3,7,11,15-tetramethyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.263g/cm3 |
|---|---|
| Boiling Point | 642.4ºC at 760 mmHg |
| Molecular Formula | C33H33N3O3 |
| Molecular Weight | 519.63300 |
| Flash Point | 169.1ºC |
| Exact Mass | 519.25200 |
| PSA | 37.41000 |
| LogP | 5.55660 |
| Index of Refraction | 1.66 |
| InChIKey | NGICUFHMVYDEGV-UHFFFAOYSA-N |
| SMILES | c1ccc(CN2COc3c(c4c(c5c3CN(Cc3ccccc3)CO5)CN(Cc3ccccc3)CO4)C2)cc1 |
|
~%
3-Hexadecen-1-o... CAS#:6638-82-0 |
| Literature: Burke; Weatherbee Journal of the American Chemical Society, 1950 , vol. 72, p. 4691,4693 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3,7,11-tribenzyl-3,4,7,8,11,12-hexahydro-2H,6H,10H-benzo[1,2-e,3,4-e',5,6-e'']tris[1,3]oxazine |