Propanediamide,2-(acetylamino)-N1,N3-bis(2-hydroxyethyl)- structure
|
Common Name | Propanediamide,2-(acetylamino)-N1,N3-bis(2-hydroxyethyl)- | ||
|---|---|---|---|---|
| CAS Number | 6640-66-0 | Molecular Weight | 247.24800 | |
| Density | 1.299g/cm3 | Boiling Point | 738.9ºC at 760mmHg | |
| Molecular Formula | C9H17N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 400.7ºC | |
| Name | 2-acetamido-N1,N3-bis(2-hydroxyethyl)malonamide |
|---|
| Density | 1.299g/cm3 |
|---|---|
| Boiling Point | 738.9ºC at 760mmHg |
| Molecular Formula | C9H17N3O5 |
| Molecular Weight | 247.24800 |
| Flash Point | 400.7ºC |
| Exact Mass | 247.11700 |
| PSA | 127.76000 |
| Index of Refraction | 1.517 |
| InChIKey | RBRQNGXXHZJPFO-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(C(=O)NCCO)C(=O)NCCO |
|
~%
Propanediamide,... CAS#:6640-66-0 |
| Literature: Kazlauskas,D.A.; Bal'site,E.B. Journal of Organic Chemistry USSR (English Translation), 1972 , vol. 8, p. 2338 - 2343 Zhurnal Organicheskoi Khimii, 1972 , vol. 8, p. 2291 - 2297 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |