Phenol,2,2'-[(cyclohexylimino)bis(methylene)]bis[6-bromo-4-(1,1-dimethylethyl)- (9CI) structure
|
Common Name | Phenol,2,2'-[(cyclohexylimino)bis(methylene)]bis[6-bromo-4-(1,1-dimethylethyl)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 6640-97-7 | Molecular Weight | 581.42300 | |
| Density | 1.39g/cm3 | Boiling Point | 556ºC at 760 mmHg | |
| Molecular Formula | C28H39Br2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 290.1ºC | |
| Name | 2-bromo-6-[[(3-bromo-5-tert-butyl-2-hydroxyphenyl)methyl-cyclohexylamino]methyl]-4-tert-butylphenol |
|---|
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 556ºC at 760 mmHg |
| Molecular Formula | C28H39Br2NO2 |
| Molecular Weight | 581.42300 |
| Flash Point | 290.1ºC |
| Exact Mass | 579.13500 |
| PSA | 43.70000 |
| LogP | 8.55270 |
| Index of Refraction | 1.615 |
| InChIKey | NQIXBTDGJGXIGS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(Br)c(O)c(CN(Cc2cc(C(C)(C)C)cc(Br)c2O)C2CCCCC2)c1 |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |