Benzenemethanol, 3,3'-[(5-chloro-2-hydroxy-1,3-phenylene)bis(methylene)]bis[5-chloro-2-hydroxy
![Benzenemethanol, 3,3'-[(5-chloro-2-hydroxy-1,3-phenylene)bis(methylene)]bis[5-chloro-2-hydroxy Structure](https://image.chemsrc.com/caspic/014/6641-20-9.png)
Benzenemethanol, 3,3'-[(5-chloro-2-hydroxy-1,3-phenylene)bis(methylene)]bis[5-chloro-2-hydroxy structure
|
Common Name | Benzenemethanol, 3,3'-[(5-chloro-2-hydroxy-1,3-phenylene)bis(methylene)]bis[5-chloro-2-hydroxy | ||
|---|---|---|---|---|
| CAS Number | 6641-20-9 | Molecular Weight | 469.74200 | |
| Density | 1.53g/cm3 | Boiling Point | 673.8ºC at 760mmHg | |
| Molecular Formula | C22H19Cl3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 361.3ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-chloro-2,6-bis[[5-chloro-2-hydroxy-3-(hydroxymethyl)phenyl]methyl]phenol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.53g/cm3 |
|---|---|
| Boiling Point | 673.8ºC at 760mmHg |
| Molecular Formula | C22H19Cl3O5 |
| Molecular Weight | 469.74200 |
| Flash Point | 361.3ºC |
| Exact Mass | 468.03000 |
| PSA | 101.15000 |
| LogP | 4.92980 |
| Index of Refraction | 1.695 |
| InChIKey | PWIHARYGBUXQKM-UHFFFAOYSA-N |
| SMILES | OCc1cc(Cl)cc(Cc2cc(Cl)cc(Cc3cc(Cl)cc(CO)c3O)c2O)c1O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
Benzenemethanol... CAS#:6641-20-9 |
| Literature: Zinke; Hanus Chemische Berichte, 1941 , vol. 74, p. 205,211 |
|
~%
Benzenemethanol... CAS#:6641-20-9 |
| Literature: Zinke; Hanus Chemische Berichte, 1941 , vol. 74, p. 205,211 |
![Phenol,4-chloro-2,6-bis[(5-chloro-2-hydroxyphenyl)methyl] structure](https://image.chemsrc.com/caspic/306/6642-07-5.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 4-chloro-2,6-bis[[5-chloro-2-hydroxy-3-(hydroxymethyl)phenyl]methyl]phenol? |
| A: LogP of 4-chloro-2,6-bis[[5-chloro-2-hydroxy-3-(hydroxymethyl)phenyl]methyl]phenol is 4.92980. |
| Q: What is the InChIKey of 4-chloro-2,6-bis[[5-chloro-2-hydroxy-3-(hydroxymethyl)phenyl]methyl]phenol? |
| A: InChIKey of 4-chloro-2,6-bis[[5-chloro-2-hydroxy-3-(hydroxymethyl)phenyl]methyl]phenol is PWIHARYGBUXQKM-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 6641-20-9? |
| A: Chinese name of 6641-20-9 is 6641-20-9. |
| Q: What are the upstream materials of 4-chloro-2,6-bis[[5-chloro-2-hydroxy-3-(hydroxymethyl)phenyl]methyl]phenol? |
| A: Related upstream materials(CAS) of 4-chloro-2,6-bis[[5-chloro-2-hydroxy-3-(hydroxymethyl)phenyl]methyl]phenol: 50-00-0;6642-07-5;67-56-1. |
| Q: What is the boiling point of 4-chloro-2,6-bis[[5-chloro-2-hydroxy-3-(hydroxymethyl)phenyl]methyl]phenol? |
| A: Boiling point of 4-chloro-2,6-bis[[5-chloro-2-hydroxy-3-(hydroxymethyl)phenyl]methyl]phenol is 673.8ºC at 760mmHg. |
| Q: What is the polar surface area (PSA) of 4-chloro-2,6-bis[[5-chloro-2-hydroxy-3-(hydroxymethyl)phenyl]methyl]phenol? |
| A: Polar surface area (PSA) of 4-chloro-2,6-bis[[5-chloro-2-hydroxy-3-(hydroxymethyl)phenyl]methyl]phenol is 101.15000. |
| Q: What is the CAS number of 4-chloro-2,6-bis[[5-chloro-2-hydroxy-3-(hydroxymethyl)phenyl]methyl]phenol? |
| A: CAS number of 4-chloro-2,6-bis[[5-chloro-2-hydroxy-3-(hydroxymethyl)phenyl]methyl]phenol is 6641-20-9. |
| Q: What is the molecular weight of 4-chloro-2,6-bis[[5-chloro-2-hydroxy-3-(hydroxymethyl)phenyl]methyl]phenol? |
| A: Molecular weight of 4-chloro-2,6-bis[[5-chloro-2-hydroxy-3-(hydroxymethyl)phenyl]methyl]phenol is 469.74200. |
| Q: What is the molecular formula of 4-chloro-2,6-bis[[5-chloro-2-hydroxy-3-(hydroxymethyl)phenyl]methyl]phenol? |
| A: Molecular formula of 4-chloro-2,6-bis[[5-chloro-2-hydroxy-3-(hydroxymethyl)phenyl]methyl]phenol is C22H19Cl3O5. |
| Q: What is the English name of 4-chloro-2,6-bis[[5-chloro-2-hydroxy-3-(hydroxymethyl)phenyl]methyl]phenol? |
| A: The English name of 4-chloro-2,6-bis[[5-chloro-2-hydroxy-3-(hydroxymethyl)phenyl]methyl]phenol is 4-chloro-2,6-bis[[5-chloro-2-hydroxy-3-(hydroxymethyl)phenyl]methyl]phenol. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |