4-piperidin-1-ylaniline,hydrochloride
Modify Date: 2025-10-09 16:48:13
4-piperidin-1-ylaniline,hydrochloride structure
|
Common Name | 4-piperidin-1-ylaniline,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 6641-28-7 | Molecular Weight | 212.71900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H17ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-piperidin-1-ylaniline,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H17ClN2 |
|---|---|
| Molecular Weight | 212.71900 |
| Exact Mass | 212.10800 |
| PSA | 29.26000 |
| LogP | 3.70730 |
| InChIKey | HZLBCGZSDLAQOA-UHFFFAOYSA-N |
| SMILES | Cl.Cl.Nc1ccc(N2CCCCC2)cc1 |
|
~%
4-piperidin-1-y... CAS#:6641-28-7 |
| Literature: Takeda Chemical Industries, Ltd. Patent: US5580883 A1, 1996 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 2, Current Page 1 of 1
1
| 4-Piperidino-anilin,Dihydrochlorid |
| 4'-Fluoro-4-piperidinobutyrophenone hydrochloride |
| BUTYROPHENONE,4'-FLUORO-4-PIPERIDINO-,HYDROCHLORIDE |
| 4-piperidino-4'-fluorobutyrophenone hydrochloride |
| 4-piperidino-aniline,dihydrochloride |