Hydrazinecarbothioamide,2-[(2-hydroxyphenyl)methylene]-N-[5-methyl-2-(1-methylethyl)phenyl]
Modify Date: 2025-08-31 16:39:14
![Hydrazinecarbothioamide,2-[(2-hydroxyphenyl)methylene]-N-[5-methyl-2-(1-methylethyl)phenyl] Structure](https://image.chemsrc.com/caspic/355/6641-95-8.png)
Hydrazinecarbothioamide,2-[(2-hydroxyphenyl)methylene]-N-[5-methyl-2-(1-methylethyl)phenyl] structure
|
Common Name | Hydrazinecarbothioamide,2-[(2-hydroxyphenyl)methylene]-N-[5-methyl-2-(1-methylethyl)phenyl] | ||
|---|---|---|---|---|
| CAS Number | 6641-95-8 | Molecular Weight | 327.44400 | |
| Density | 1.261g/cm3 | Boiling Point | 454.6ºC at 760mmHg | |
| Molecular Formula | C18H21N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.7ºC | |
| Name | 1-(5-methyl-2-propan-2-ylphenyl)-3-[[(E)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]thiourea |
|---|
| Density | 1.261g/cm3 |
|---|---|
| Boiling Point | 454.6ºC at 760mmHg |
| Molecular Formula | C18H21N3OS |
| Molecular Weight | 327.44400 |
| Flash Point | 228.7ºC |
| Exact Mass | 327.14100 |
| PSA | 88.74000 |
| LogP | 4.60840 |
| Index of Refraction | 1.702 |
| InChIKey | ULJDZNXHFHUQTO-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(C)C)c(NC(=S)NN=Cc2ccccc2O)c1 |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 2, Current Page 1 of 1
1