6,6-Dimethyl-2,4-dioxo-3-(1-oxobutyl)cyclohexane-1-carboxylic acid methyl ester structure
|
Common Name | 6,6-Dimethyl-2,4-dioxo-3-(1-oxobutyl)cyclohexane-1-carboxylic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 66421-41-8 | Molecular Weight | 268.30600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 5-butanoyl-2,2-dimethyl-4,6-dioxocyclohexane-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H20O5 |
|---|---|
| Molecular Weight | 268.30600 |
| Exact Mass | 268.13100 |
| PSA | 77.51000 |
| LogP | 1.32910 |
| InChIKey | RIYBRKZTWIDBPE-UHFFFAOYSA-N |
| SMILES | CCCC(=O)C1C(=O)CC(C)(C)C(C(=O)OC)C1=O |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-butyryl-4-methoxycarbonyl-5,5-dimethylcyclohexane-1,3-dione |
| 2-Butanoyl-4-carbomethoxy-5,5-dimethyl-cyclohexandion-1,3 |
| 6,6-Dimethyl-2,4-dioxo-3-(1-oxobutyl)cyclohexane-1-carboxylic acid methyl ester |