4-[1-(4-hydroxyphenyl)-3-methylbut-1-enyl]phenol structure
|
Common Name | 4-[1-(4-hydroxyphenyl)-3-methylbut-1-enyl]phenol | ||
|---|---|---|---|---|
| CAS Number | 66422-07-9 | Molecular Weight | 254.32400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[1-(4-hydroxyphenyl)-3-methylbut-1-enyl]phenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H18O2 |
|---|---|
| Molecular Weight | 254.32400 |
| Exact Mass | 254.13100 |
| PSA | 40.46000 |
| LogP | 4.18550 |
| InChIKey | DDEWRRMILVWZOZ-UHFFFAOYSA-N |
| SMILES | CC(C)C=C(c1ccc(O)cc1)c1ccc(O)cc1 |
|
~85%
4-[1-(4-hydroxy... CAS#:66422-07-9 |
| Literature: Gilbert, Jacques; Fuentes, Maryse; Ojasoo, Tiiu; Dore, Jean-Christophe; Pons, Michel Journal of Medicinal Chemistry, 1997 , vol. 40, # 7 p. 1104 - 1111 |
|
~85%
4-[1-(4-hydroxy... CAS#:66422-07-9 |
| Literature: Zhu, Hua; Huang, Liliang; Xu, Xiaoping; Shen, Yu-Mei Synthetic Communications, 2010 , vol. 40, # 22 p. 3322 - 3331 |
|
~%
4-[1-(4-hydroxy... CAS#:66422-07-9 |
| Literature: Gilbert, Jacques; Fuentes, Maryse; Ojasoo, Tiiu; Dore, Jean-Christophe; Pons, Michel Journal of Medicinal Chemistry, 1997 , vol. 40, # 7 p. 1104 - 1111 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,1-bis(4-hydroxyphenyl)-3-methyl-1-butene |
| Phenol,4,4'-(3-methyl-1-butenylidene)bis |
| 4-[1-(4-hydroxyphenyl)-3-methyl-1-butenyl]phenol |
| 1,1-Bis-(4-hydroxy-phenyl)-3-methyl-but-1-en |
| iso-[bis(4-hydroxyphenyl)methylene]butane |