Chandrananimycin A
Modify Date: 2026-05-08 20:07:48
Chandrananimycin A structure
|
Common Name | Chandrananimycin A | ||
|---|---|---|---|---|
| CAS Number | 664355-12-8 | Molecular Weight | 270.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Chandrananimycin A |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H10N2O4 |
|---|---|
| Molecular Weight | 270.24 |
| InChIKey | VRKDUDPRCAZBHW-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC2=NC3=C(C=CC=C3OC2=CC1=O)O |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibition of human recombinant N-terminus 6X-histidine-tagged indoleamine 2,3-dioxyg...
Source: ChEMBL
Target: Indoleamine 2,3-dioxygenase 1
External Id: CHEMBL2330525
|
|
Name: Inhibition of human recombinant N-terminus 6X-histidine-tagged indoleamine 2,3-dioxyg...
Source: ChEMBL
Target: Indoleamine 2,3-dioxygenase 1
External Id: CHEMBL2330524
|
|
Name: Inhibition of human recombinant N-terminus 6X-histidine-tagged indoleamine 2,3-dioxyg...
Source: ChEMBL
Target: Indoleamine 2,3-dioxygenase 1
External Id: CHEMBL2330523
|
Total 3, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Chandrananimycin A? |
| A: SMILES notation of Chandrananimycin A is CC(=O)NC1=CC2=NC3=C(C=CC=C3OC2=CC1=O)O. |
| Q: What is the English name of Chandrananimycin A? |
| A: The English name of Chandrananimycin A is Chandrananimycin A. |
| Q: What is the Chinese name of 664355-12-8? |
| A: Chinese name of 664355-12-8 is 664355-12-8. |
| Q: What is the molecular weight of Chandrananimycin A? |
| A: Molecular weight of Chandrananimycin A is 270.24. |
| Q: What is the molecular formula of Chandrananimycin A? |
| A: Molecular formula of Chandrananimycin A is C14H10N2O4. |
| Q: What is the InChIKey of Chandrananimycin A? |
| A: InChIKey of Chandrananimycin A is VRKDUDPRCAZBHW-UHFFFAOYSA-N. |
| Q: What is the CAS number of Chandrananimycin A? |
| A: CAS number of Chandrananimycin A is 664355-12-8. |