Chandrananimycin A
Modify Date: 2026-04-08 17:29:34
Chandrananimycin A structure
|
Common Name | Chandrananimycin A | ||
|---|---|---|---|---|
| CAS Number | 664355-12-8 | Molecular Weight | 270.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Chandrananimycin A |
|---|
| Molecular Formula | C14H10N2O4 |
|---|---|
| Molecular Weight | 270.24 |
| InChIKey | VRKDUDPRCAZBHW-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC2=NC3=C(C=CC=C3OC2=CC1=O)O |
|
Name: Inhibition of human recombinant N-terminus 6X-histidine-tagged indoleamine 2,3-dioxyg...
Source: ChEMBL
Target: Indoleamine 2,3-dioxygenase 1
External Id: CHEMBL2330525
|
|
Name: Inhibition of human recombinant N-terminus 6X-histidine-tagged indoleamine 2,3-dioxyg...
Source: ChEMBL
Target: Indoleamine 2,3-dioxygenase 1
External Id: CHEMBL2330524
|
|
Name: Inhibition of human recombinant N-terminus 6X-histidine-tagged indoleamine 2,3-dioxyg...
Source: ChEMBL
Target: Indoleamine 2,3-dioxygenase 1
External Id: CHEMBL2330523
|
Total 3, Current Page 1 of 1
1