4-benzyl-2-(2-phenyloxiran-2-yl)morpholine structure
|
Common Name | 4-benzyl-2-(2-phenyloxiran-2-yl)morpholine | ||
|---|---|---|---|---|
| CAS Number | 664361-21-1 | Molecular Weight | 295.37600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-benzyl-2-(2-phenyloxiran-2-yl)morpholine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H21NO2 |
|---|---|
| Molecular Weight | 295.37600 |
| Exact Mass | 295.15700 |
| PSA | 25.00000 |
| LogP | 2.75100 |
| InChIKey | LNMDBGRIEPCIOY-UHFFFAOYSA-N |
| SMILES | c1ccc(CN2CCOC(C3(c4ccccc4)CO3)C2)cc1 |
|
~78%
4-benzyl-2-(2-p... CAS#:664361-21-1 |
| Literature: ELI LILLY AND COMPANY Patent: WO2005/60949 A2, 2005 ; Location in patent: Page/Page column 145 ; WO 2005/060949 A2 |
|
~78%
4-benzyl-2-(2-p... CAS#:664361-21-1 |
| Literature: Eli Lilly and Compony Patent: WO2004/18441 A1, 2004 ; Location in patent: Page 39-40 ; WO 2004/018441 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Morpholine,4-(phenylmethyl)-2-(2-phenyloxiranyl) |
| 4-benzyl-2-(2-phenyl-oxiranyl)-morpholine |