2-(6-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl)-2,3,3-trifluorooxirane structure
|
Common Name | 2-(6-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl)-2,3,3-trifluorooxirane | ||
|---|---|---|---|---|
| CAS Number | 66443-82-1 | Molecular Weight | 432.51400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8ClF15O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(6-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl)-2,3,3-trifluorooxirane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8ClF15O |
|---|---|
| Molecular Weight | 432.51400 |
| Exact Mass | 431.94000 |
| PSA | 12.53000 |
| LogP | 5.28330 |
| InChIKey | QRAOUEBOJOCMCE-UHFFFAOYSA-N |
| SMILES | FC(F)(Cl)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)OC1(F)F |
| HS Code | 2910900090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2910900090 |
|---|---|
| Summary | 2910900090. epoxides, epoxyalcohols, epoxyphenols and epoxyethers, with a three-membered ring, and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| (6-Chloroperfluorohexyl)trifluorooxirane |