6-(4-Methylphenyl)furo[2,3-b]pyrazine
Modify Date: 2026-07-22 20:00:36
![6-(4-Methylphenyl)furo[2,3-b]pyrazine Structure](https://www.chemsrc.com/extcaspic/408/66479-91-2.png)
6-(4-Methylphenyl)furo[2,3-b]pyrazine structure
|
Common Name | 6-(4-Methylphenyl)furo[2,3-b]pyrazine | ||
|---|---|---|---|---|
| CAS Number | 66479-91-2 | Molecular Weight | 210.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-(4-Methylphenyl)furo[2,3-b]pyrazine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H10N2O |
|---|---|
| Molecular Weight | 210.23 |
| InChIKey | GIBVGTWZORZLAI-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2cc3nccnc3o2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 6-(4-Methylphenyl)furo[2,3-b]pyrazine? |
| A: Molecular weight of 6-(4-Methylphenyl)furo[2,3-b]pyrazine is 210.23. |
| Q: What is the CAS number of 6-(4-Methylphenyl)furo[2,3-b]pyrazine? |
| A: CAS number of 6-(4-Methylphenyl)furo[2,3-b]pyrazine is 66479-91-2. |
| Q: What is the English name of 6-(4-Methylphenyl)furo[2,3-b]pyrazine? |
| A: The English name of 6-(4-Methylphenyl)furo[2,3-b]pyrazine is 6-(4-Methylphenyl)furo[2,3-b]pyrazine. |
| Q: What is the SMILES notation of 6-(4-Methylphenyl)furo[2,3-b]pyrazine? |
| A: SMILES notation of 6-(4-Methylphenyl)furo[2,3-b]pyrazine is Cc1ccc(-c2cc3nccnc3o2)cc1. |
| Q: What is the Chinese name of 66479-91-2? |
| A: Chinese name of 66479-91-2 is 66479-91-2. |
| Q: What is the molecular formula of 6-(4-Methylphenyl)furo[2,3-b]pyrazine? |
| A: Molecular formula of 6-(4-Methylphenyl)furo[2,3-b]pyrazine is C13H10N2O. |
| Q: What is the InChIKey of 6-(4-Methylphenyl)furo[2,3-b]pyrazine? |
| A: InChIKey of 6-(4-Methylphenyl)furo[2,3-b]pyrazine is GIBVGTWZORZLAI-UHFFFAOYSA-N. |