Methyl 3,10-dioxo-7,10-dihydro-3H-pyrano(3,2-f)quinoline-8-carboxylate structure
|
Common Name | Methyl 3,10-dioxo-7,10-dihydro-3H-pyrano(3,2-f)quinoline-8-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 66496-89-7 | Molecular Weight | 271.22500 | |
| Density | 1.463g/cm3 | Boiling Point | 503.7ºC at 760 mmHg | |
| Molecular Formula | C14H9NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.4ºC | |
| Name | methyl 3,10-dioxo-7H-pyrano[3,2-f]quinoline-8-carboxylate |
|---|
| Density | 1.463g/cm3 |
|---|---|
| Boiling Point | 503.7ºC at 760 mmHg |
| Molecular Formula | C14H9NO5 |
| Molecular Weight | 271.22500 |
| Flash Point | 258.4ºC |
| Exact Mass | 271.04800 |
| PSA | 89.37000 |
| LogP | 1.42110 |
| Index of Refraction | 1.63 |
| InChIKey | KZCKCTCVCKQAJF-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(=O)c2c(ccc3oc(=O)ccc32)[nH]1 |
|
~%
Methyl 3,10-dio... CAS#:66496-89-7 |
| Literature: Khan,M.A.; Gemal,A.L. Journal of Heterocyclic Chemistry, 1978 , vol. 15, p. 159 - 160 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |