2-(N-(Cyclopropylmethyl)-N-(2,6-dibromophenyl)amino)-2-imidazoline structure
|
Common Name | 2-(N-(Cyclopropylmethyl)-N-(2,6-dibromophenyl)amino)-2-imidazoline | ||
|---|---|---|---|---|
| CAS Number | 66542-09-4 | Molecular Weight | 373.08600 | |
| Density | 1.84g/cm3 | Boiling Point | 415.9ºC at 760 mmHg | |
| Molecular Formula | C13H15Br2N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.3ºC | |
| Name | N-(cyclopropylmethyl)-N-(2,6-dibromophenyl)-4,5-dihydro-1H-imidazol-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.84g/cm3 |
|---|---|
| Boiling Point | 415.9ºC at 760 mmHg |
| Molecular Formula | C13H15Br2N3 |
| Molecular Weight | 373.08600 |
| Flash Point | 205.3ºC |
| Exact Mass | 370.96300 |
| PSA | 27.63000 |
| LogP | 3.15160 |
| Index of Refraction | 1.723 |
| InChIKey | ZRUVYWZNRHMCBG-UHFFFAOYSA-N |
| SMILES | Brc1cccc(Br)c1N(CC1CC1)C1=NCCN1 |
| HS Code | 2933290090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| cyclopropylmethyl-(2,6-dibromo-phenyl)-(4,5-dihydro-1H-imidazol-2-yl)-amine |
| 2-<N-(cyclopropylmethyl)-N-(2,6-dibromophenyl)amino>-2-imidazoline |
| Sth-2148 |