6-(3-nitro-phenyl)-[1,2,4]triazolo[4,3-b]pyridazine
![6-(3-nitro-phenyl)-[1,2,4]triazolo[4,3-b]pyridazine Structure](https://image.chemsrc.com/caspic/107/66548-75-2.png)
6-(3-nitro-phenyl)-[1,2,4]triazolo[4,3-b]pyridazine structure
|
Common Name | 6-(3-nitro-phenyl)-[1,2,4]triazolo[4,3-b]pyridazine | ||
|---|---|---|---|---|
| CAS Number | 66548-75-2 | Molecular Weight | 241.20600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H7N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-(3-nitro-phenyl)-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H7N5O2 |
|---|---|
| Molecular Weight | 241.20600 |
| Exact Mass | 241.06000 |
| PSA | 88.90000 |
| LogP | 2.22270 |
| InChIKey | QOFLRBIXKONWGZ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(-c2ccc3nncn3n2)c1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
![3-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)aniline structure](https://image.chemsrc.com/caspic/031/66548-77-4.png)
CAS#:66548-77-4This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 6-(m-nitrophenyl)-1,2,4-triazolo[4,3-b]pyridazine |
| 6-(3-Nitrophenyl)-1,2,4-triazolo-[4,3-b]pyridazin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 6-(3-nitro-phenyl)-[1,2,4]triazolo[4,3-b]pyridazine? |
| A: InChIKey of 6-(3-nitro-phenyl)-[1,2,4]triazolo[4,3-b]pyridazine is QOFLRBIXKONWGZ-UHFFFAOYSA-N. |
| Q: What English synonyms does 6-(3-nitro-phenyl)-[1,2,4]triazolo[4,3-b]pyridazine have? |
| A: English synonyms of 6-(3-nitro-phenyl)-[1,2,4]triazolo[4,3-b]pyridazine: 6-(m-nitrophenyl)-1,2,4-triazolo[4,3-b]pyridazine, 6-(3-Nitrophenyl)-1,2,4-triazolo-[4,3-b]pyridazin. |
| Q: What is the polar surface area (PSA) of 6-(3-nitro-phenyl)-[1,2,4]triazolo[4,3-b]pyridazine? |
| A: Polar surface area (PSA) of 6-(3-nitro-phenyl)-[1,2,4]triazolo[4,3-b]pyridazine is 88.90000. |
| Q: What are the downstream products of 6-(3-nitro-phenyl)-[1,2,4]triazolo[4,3-b]pyridazine? |
| A: Related downstream products(CAS) of 6-(3-nitro-phenyl)-[1,2,4]triazolo[4,3-b]pyridazine: 66548-77-4. |
| Q: What is the LogP of 6-(3-nitro-phenyl)-[1,2,4]triazolo[4,3-b]pyridazine? |
| A: LogP of 6-(3-nitro-phenyl)-[1,2,4]triazolo[4,3-b]pyridazine is 2.22270. |
| Q: What is the CAS number of 6-(3-nitro-phenyl)-[1,2,4]triazolo[4,3-b]pyridazine? |
| A: CAS number of 6-(3-nitro-phenyl)-[1,2,4]triazolo[4,3-b]pyridazine is 66548-75-2. |
| Q: What is the Chinese name of 66548-75-2? |
| A: Chinese name of 66548-75-2 is 66548-75-2. |
| Q: What is the English name of 6-(3-nitro-phenyl)-[1,2,4]triazolo[4,3-b]pyridazine? |
| A: The English name of 6-(3-nitro-phenyl)-[1,2,4]triazolo[4,3-b]pyridazine is 6-(3-nitro-phenyl)-[1,2,4]triazolo[4,3-b]pyridazine. |
| Q: What is the molecular formula of 6-(3-nitro-phenyl)-[1,2,4]triazolo[4,3-b]pyridazine? |
| A: Molecular formula of 6-(3-nitro-phenyl)-[1,2,4]triazolo[4,3-b]pyridazine is C11H7N5O2. |
| Q: What is the SMILES notation of 6-(3-nitro-phenyl)-[1,2,4]triazolo[4,3-b]pyridazine? |
| A: SMILES notation of 6-(3-nitro-phenyl)-[1,2,4]triazolo[4,3-b]pyridazine is O=[N+]([O-])c1cccc(-c2ccc3nncn3n2)c1. |